C13H9F2IN2O — CID 47103689
1-(2,4-difluorophenyl)-3-(3-iodophenyl)urea (PubChem CID 47103689) has the molecular formula C13H9F2IN2O and a molecular weight of 374.13 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(3-iodophenyl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(3-iodophenyl)urea |
|---|---|
| PubChem CID | 47103689 |
| Molecular Formula | C13H9F2IN2O |
| Molecular Weight | 374.13 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(3-iodophenyl)urea |
| SMILES | O=C(Nc1cccc(I)c1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C13H9F2IN2O/c14-8-4-5-12(11(15)6-8)18-13(19)17-10-3-1-2-9(16)7-10/h1-7H,(H2,17,18,19) |
| InChIKey | AWSOEOUXAYEOIJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.13 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|