C17H14F2IN3O3 — CID 55871164
2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-(3-iodophenyl)propanamide (PubChem CID 55871164) has the molecular formula C17H14F2IN3O3 and a molecular weight of 473.22 g/mol. Its IUPAC name is 2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-(3-iodophenyl)propanamide.
| Compound Name | 2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-(3-iodophenyl)propanamide |
|---|---|
| PubChem CID | 55871164 |
| Molecular Formula | C17H14F2IN3O3 |
| Molecular Weight | 473.22 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | 2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-(3-iodophenyl)propanamide |
| SMILES | CC(O/N=C/C(=O)Nc1ccc(F)cc1F)C(=O)Nc1cccc(I)c1 |
| InChI | InChI=1S/C17H14F2IN3O3/c1-10(17(25)22-13-4-2-3-12(20)8-13)26-21-9-16(24)23-15-6-5-11(18)7-14(15)19/h2-10H,1H3,(H,22,25)(H,23,24)/b21-9+ |
| InChIKey | CTWUMNIARJYGTA-ZVBGSRNCSA-N |
| XLogP | 3.54 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|