C18H14F5N3O3 — CID 55870389
2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 55870389) has the molecular formula C18H14F5N3O3 and a molecular weight of 415.32 g/mol. Its IUPAC name is 2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 55870389 |
| Molecular Formula | C18H14F5N3O3 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(O/N=C/C(=O)Nc1ccc(F)cc1F)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H14F5N3O3/c1-10(17(28)26-14-5-3-2-4-12(14)18(21,22)23)29-24-9-16(27)25-15-7-6-11(19)8-13(15)20/h2-10H,1H3,(H,25,27)(H,26,28)/b24-9+ |
| InChIKey | KDWZEIBJXZDGGN-PGGKNCGUSA-N |
| XLogP | 3.95 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|