C16H13F2N3O4 — CID 16960640
N-(2,4-difluorophenyl)-2-[(E)-(3-nitrophenyl)methylideneamino]oxypropanamide (PubChem CID 16960640) has the molecular formula C16H13F2N3O4 and a molecular weight of 349.29 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[(E)-(3-nitrophenyl)methylideneamino]oxypropanamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[(E)-(3-nitrophenyl)methylideneamino]oxypropanamide |
|---|---|
| PubChem CID | 16960640 |
| Molecular Formula | C16H13F2N3O4 |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[(E)-(3-nitrophenyl)methylideneamino]oxypropanamide |
| SMILES | CC(O/N=C/c1cccc([N+](=O)[O-])c1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C16H13F2N3O4/c1-10(16(22)20-15-6-5-12(17)8-14(15)18)25-19-9-11-3-2-4-13(7-11)21(23)24/h2-10H,1H3,(H,20,22)/b19-9+ |
| InChIKey | PXZCYBHNVRGFQO-DJKKODMXSA-N |
| XLogP | 3.25 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|