C18H12F2N2O5S — CID 8732071
[(2R)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate (PubChem CID 8732071) has the molecular formula C18H12F2N2O5S and a molecular weight of 406.37 g/mol. Its IUPAC name is [(2R)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate.
| Compound Name | [(2R)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 8732071 |
| Molecular Formula | C18H12F2N2O5S |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | [(2R)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cc2cc([N+](=O)[O-])ccc2s1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C18H12F2N2O5S/c1-9(17(23)21-14-4-2-11(19)8-13(14)20)27-18(24)16-7-10-6-12(22(25)26)3-5-15(10)28-16/h2-9H,1H3,(H,21,23)/t9-/m1/s1 |
| InChIKey | DABNAYDNRWBPGF-SECBINFHSA-N |
| XLogP | 4.27 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|