C20H14F3N3O6S — CID 46806765
[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate (PubChem CID 46806765) has the molecular formula C20H14F3N3O6S and a molecular weight of 481.41 g/mol. Its IUPAC name is [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate.
| Compound Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 46806765 |
| Molecular Formula | C20H14F3N3O6S |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate |
| SMILES | CC(OC(=O)c1cc2cc([N+](=O)[O-])ccc2s1)C(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H14F3N3O6S/c1-9(19(28)24-8-16(27)25-13-4-3-12(21)17(22)18(13)23)32-20(29)15-7-10-6-11(26(30)31)2-5-14(10)33-15/h2-7,9H,8H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | FHGIHRPZMHLRME-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|