C18H15N3O7S2 — CID 46806815
[1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate (PubChem CID 46806815) has the molecular formula C18H15N3O7S2 and a molecular weight of 449.47 g/mol. Its IUPAC name is [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate.
| Compound Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 46806815 |
| Molecular Formula | C18H15N3O7S2 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate |
| SMILES | CC(OC(=O)c1cc2cc([N+](=O)[O-])ccc2s1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H15N3O7S2/c1-10(17(22)20-12-2-5-14(6-3-12)30(19,26)27)28-18(23)16-9-11-8-13(21(24)25)4-7-15(11)29-16/h2-10H,1H3,(H,20,22)(H2,19,26,27) |
| InChIKey | VLUWPZQBVGSJRG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|