C20H19N3O7S2 — CID 46621344
[1-oxo-1-[2-(4-sulfamoylphenyl)ethylamino]propan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate (PubChem CID 46621344) has the molecular formula C20H19N3O7S2 and a molecular weight of 477.52 g/mol. Its IUPAC name is [1-oxo-1-[2-(4-sulfamoylphenyl)ethylamino]propan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate.
| Compound Name | [1-oxo-1-[2-(4-sulfamoylphenyl)ethylamino]propan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 46621344 |
| Molecular Formula | C20H19N3O7S2 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | [1-oxo-1-[2-(4-sulfamoylphenyl)ethylamino]propan-2-yl] 5-nitro-1-benzothiophene-2-carboxylate |
| SMILES | CC(OC(=O)c1cc2cc([N+](=O)[O-])ccc2s1)C(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H19N3O7S2/c1-12(19(24)22-9-8-13-2-5-16(6-3-13)32(21,28)29)30-20(25)18-11-14-10-15(23(26)27)4-7-17(14)31-18/h2-7,10-12H,8-9H2,1H3,(H,22,24)(H2,21,28,29) |
| InChIKey | HRBUOZRTSJXJNA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|