C17H15FN2O3S2 — CID 9402339
5-fluoro-N-[2-(4-sulfamoylphenyl)ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 9402339) has the molecular formula C17H15FN2O3S2 and a molecular weight of 378.45 g/mol. Its IUPAC name is 5-fluoro-N-[2-(4-sulfamoylphenyl)ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 5-fluoro-N-[2-(4-sulfamoylphenyl)ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 9402339 |
| Molecular Formula | C17H15FN2O3S2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 5-fluoro-N-[2-(4-sulfamoylphenyl)ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2cc3cc(F)ccc3s2)cc1 |
| InChI | InChI=1S/C17H15FN2O3S2/c18-13-3-6-15-12(9-13)10-16(24-15)17(21)20-8-7-11-1-4-14(5-2-11)25(19,22)23/h1-6,9-10H,7-8H2,(H,20,21)(H2,19,22,23) |
| InChIKey | SYISDSFQWSQYFF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |