C19H17FN2O5S2 — CID 30149057
[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 5-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 30149057) has the molecular formula C19H17FN2O5S2 and a molecular weight of 436.49 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 5-fluoro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 5-fluoro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 30149057 |
| Molecular Formula | C19H17FN2O5S2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 5-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)COC(=O)c2cc3cc(F)ccc3s2)cc1 |
| InChI | InChI=1S/C19H17FN2O5S2/c20-14-3-6-16-13(9-14)10-17(28-16)19(24)27-11-18(23)22-8-7-12-1-4-15(5-2-12)29(21,25)26/h1-6,9-10H,7-8,11H2,(H,22,23)(H2,21,25,26) |
| InChIKey | MFJUHFAIIKTGQS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |