C11H9FO2S — CID 23261724
ethyl 5-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 23261724) has the molecular formula C11H9FO2S and a molecular weight of 224.26 g/mol. Its IUPAC name is ethyl 5-fluoro-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 5-fluoro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 23261724 |
| Molecular Formula | C11H9FO2S |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | ethyl 5-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C11H9FO2S/c1-2-14-11(13)10-6-7-5-8(12)3-4-9(7)15-10/h3-6H,2H2,1H3 |
| InChIKey | PQGYDIBMOHLOAA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |