C15H15FN2O4S — CID 43029439
[1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 5-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 43029439) has the molecular formula C15H15FN2O4S and a molecular weight of 338.36 g/mol. Its IUPAC name is [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 5-fluoro-1-benzothiophene-2-carboxylate.
| Compound Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 5-fluoro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 43029439 |
| Molecular Formula | C15H15FN2O4S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 5-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | CCNC(=O)NC(=O)C(C)OC(=O)c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C15H15FN2O4S/c1-3-17-15(21)18-13(19)8(2)22-14(20)12-7-9-6-10(16)4-5-11(9)23-12/h4-8H,3H2,1-2H3,(H2,17,18,19,21) |
| InChIKey | FAIXCRUFXOJHQR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |