C16H24N2O4S — CID 16512861
[1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-ethyl-5-propylthiophene-2-carboxylate (PubChem CID 16512861) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-ethyl-5-propylthiophene-2-carboxylate.
| Compound Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-ethyl-5-propylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 16512861 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-ethyl-5-propylthiophene-2-carboxylate |
| SMILES | CCCc1sc(C(=O)OC(C)C(=O)NC(=O)NCC)cc1CC |
| InChI | InChI=1S/C16H24N2O4S/c1-5-8-12-11(6-2)9-13(23-12)15(20)22-10(4)14(19)18-16(21)17-7-3/h9-10H,5-8H2,1-4H3,(H2,17,18,19,21) |
| InChIKey | VAKIQYGBOHQQQX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |