C15H22N2O4S — CID 42243245
[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-ethyl-5-propylthiophene-2-carboxylate (PubChem CID 42243245) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-ethyl-5-propylthiophene-2-carboxylate.
| Compound Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-ethyl-5-propylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 42243245 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-ethyl-5-propylthiophene-2-carboxylate |
| SMILES | CCCc1sc(C(=O)O[C@H](C)C(=O)NC(=O)NC)cc1CC |
| InChI | InChI=1S/C15H22N2O4S/c1-5-7-11-10(6-2)8-12(22-11)14(19)21-9(3)13(18)17-15(20)16-4/h8-9H,5-7H2,1-4H3,(H2,16,17,18,20)/t9-/m1/s1 |
| InChIKey | IPPXOXNOULAIFN-SECBINFHSA-N |
| XLogP | 2.26 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |