C17H26N2O4S — CID 7651386
[2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 4-ethyl-5-propylthiophene-2-carboxylate (PubChem CID 7651386) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 4-ethyl-5-propylthiophene-2-carboxylate.
| Compound Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 4-ethyl-5-propylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7651386 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 4-ethyl-5-propylthiophene-2-carboxylate |
| SMILES | CCCc1sc(C(=O)OCC(=O)NC(=O)N[C@@H](C)CC)cc1CC |
| InChI | InChI=1S/C17H26N2O4S/c1-5-8-13-12(7-3)9-14(24-13)16(21)23-10-15(20)19-17(22)18-11(4)6-2/h9,11H,5-8,10H2,1-4H3,(H2,18,19,20,22)/t11-/m0/s1 |
| InChIKey | NXDMBMYBFCDLRR-NSHDSACASA-N |
| XLogP | 3.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |