C14H19N3O5 — CID 9385980
[2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 4-acetyl-1H-pyrrole-2-carboxylate (PubChem CID 9385980) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 4-acetyl-1H-pyrrole-2-carboxylate.
| Compound Name | [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 4-acetyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 9385980 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 4-acetyl-1H-pyrrole-2-carboxylate |
| SMILES | CC[C@@H](C)NC(=O)NC(=O)COC(=O)c1cc(C(C)=O)c[nH]1 |
| InChI | InChI=1S/C14H19N3O5/c1-4-8(2)16-14(21)17-12(19)7-22-13(20)11-5-10(6-15-11)9(3)18/h5-6,8,15H,4,7H2,1-3H3,(H2,16,17,19,21)/t8-/m1/s1 |
| InChIKey | NGWOLMDHHGSBML-MRVPVSSYSA-N |
| XLogP | 1.00 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |