C14H17ClN2O4 — CID 7775896
[2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-chlorobenzoate (PubChem CID 7775896) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-chlorobenzoate.
| Compound Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 7775896 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-chlorobenzoate |
| SMILES | CC[C@H](C)NC(=O)NC(=O)COC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C14H17ClN2O4/c1-3-9(2)16-14(20)17-12(18)8-21-13(19)10-6-4-5-7-11(10)15/h4-7,9H,3,8H2,1-2H3,(H2,16,17,18,20)/t9-/m0/s1 |
| InChIKey | YFCUEKUHWNIBPJ-VIFPVBQESA-N |
| XLogP | 2.12 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |