C17H21N3O4 — CID 8817073
[2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 1-methylindole-3-carboxylate (PubChem CID 8817073) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 1-methylindole-3-carboxylate.
| Compound Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 1-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 8817073 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 1-methylindole-3-carboxylate |
| SMILES | CC[C@H](C)NC(=O)NC(=O)COC(=O)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C17H21N3O4/c1-4-11(2)18-17(23)19-15(21)10-24-16(22)13-9-20(3)14-8-6-5-7-12(13)14/h5-9,11H,4,10H2,1-3H3,(H2,18,19,21,23)/t11-/m0/s1 |
| InChIKey | LCINONPJOPWRMA-NSHDSACASA-N |
| XLogP | 1.96 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |