C15H18F2N2O4S — CID 8984222
[2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(difluoromethylsulfanyl)benzoate (PubChem CID 8984222) has the molecular formula C15H18F2N2O4S and a molecular weight of 360.38 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(difluoromethylsulfanyl)benzoate.
| Compound Name | [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(difluoromethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 8984222 |
| Molecular Formula | C15H18F2N2O4S |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(difluoromethylsulfanyl)benzoate |
| SMILES | CC[C@@H](C)NC(=O)NC(=O)COC(=O)c1ccccc1SC(F)F |
| InChI | InChI=1S/C15H18F2N2O4S/c1-3-9(2)18-15(22)19-12(20)8-23-13(21)10-6-4-5-7-11(10)24-14(16)17/h4-7,9,14H,3,8H2,1-2H3,(H2,18,19,20,22)/t9-/m1/s1 |
| InChIKey | LFQYZWDLJIOICS-SECBINFHSA-N |
| XLogP | 2.78 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |