C17H19F2NO3S — CID 18202386
[2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl] 2-(difluoromethylsulfanyl)benzoate (PubChem CID 18202386) has the molecular formula C17H19F2NO3S and a molecular weight of 355.41 g/mol. Its IUPAC name is [2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl] 2-(difluoromethylsulfanyl)benzoate.
| Compound Name | [2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl] 2-(difluoromethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 18202386 |
| Molecular Formula | C17H19F2NO3S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | [2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl] 2-(difluoromethylsulfanyl)benzoate |
| SMILES | C#CC(CC)(CC)NC(=O)COC(=O)c1ccccc1SC(F)F |
| InChI | InChI=1S/C17H19F2NO3S/c1-4-17(5-2,6-3)20-14(21)11-23-15(22)12-9-7-8-10-13(12)24-16(18)19/h1,7-10,16H,5-6,11H2,2-3H3,(H,20,21) |
| InChIKey | ACYLHQSCURWNRM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|