C16H18F2N2O4S — CID 8983827
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-(difluoromethylsulfanyl)benzoate (PubChem CID 8983827) has the molecular formula C16H18F2N2O4S and a molecular weight of 372.39 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-(difluoromethylsulfanyl)benzoate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-(difluoromethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 8983827 |
| Molecular Formula | C16H18F2N2O4S |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-(difluoromethylsulfanyl)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1SC(F)F)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H18F2N2O4S/c17-15(18)25-12-8-4-3-7-11(12)14(22)24-9-13(21)20-16(23)19-10-5-1-2-6-10/h3-4,7-8,10,15H,1-2,5-6,9H2,(H2,19,20,21,23) |
| InChIKey | OMSGTINBTLONDH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |