C22H24N2O4 — CID 7749935
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2,2-diphenylacetate (PubChem CID 7749935) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2,2-diphenylacetate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 7749935 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2,2-diphenylacetate |
| SMILES | O=C(COC(=O)C(c1ccccc1)c1ccccc1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C22H24N2O4/c25-19(24-22(27)23-18-13-7-8-14-18)15-28-21(26)20(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-6,9-12,18,20H,7-8,13-15H2,(H2,23,24,25,27) |
| InChIKey | MUQQERTYJSYCFD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |