C23H25N3O5 — CID 46661496
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-benzamido-2-phenylacetate (PubChem CID 46661496) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-benzamido-2-phenylacetate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-benzamido-2-phenylacetate |
|---|---|
| PubChem CID | 46661496 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-benzamido-2-phenylacetate |
| SMILES | O=C(COC(=O)C(NC(=O)c1ccccc1)c1ccccc1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C23H25N3O5/c27-19(25-23(30)24-18-13-7-8-14-18)15-31-22(29)20(16-9-3-1-4-10-16)26-21(28)17-11-5-2-6-12-17/h1-6,9-12,18,20H,7-8,13-15H2,(H,26,28)(H2,24,25,27,30) |
| InChIKey | UFELIHDVZRZQAD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |