C24H28N2O4 — CID 7795325
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 3,3-diphenylpropanoate (PubChem CID 7795325) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 3,3-diphenylpropanoate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 7795325 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 3,3-diphenylpropanoate |
| SMILES | O=C(COC(=O)CC(c1ccccc1)c1ccccc1)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C24H28N2O4/c27-22(26-24(29)25-20-14-8-3-9-15-20)17-30-23(28)16-21(18-10-4-1-5-11-18)19-12-6-2-7-13-19/h1-2,4-7,10-13,20-21H,3,8-9,14-17H2,(H2,25,26,27,29) |
| InChIKey | BRJAXUMTBLYMRJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |