C15H21N5O4 — CID 55701620
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-(pyrimidin-2-ylamino)propanoate (PubChem CID 55701620) has the molecular formula C15H21N5O4 and a molecular weight of 335.36 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-(pyrimidin-2-ylamino)propanoate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-(pyrimidin-2-ylamino)propanoate |
|---|---|
| PubChem CID | 55701620 |
| Molecular Formula | C15H21N5O4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-(pyrimidin-2-ylamino)propanoate |
| SMILES | O=C(COC(=O)CCNc1ncccn1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H21N5O4/c21-12(20-15(23)19-11-4-1-2-5-11)10-24-13(22)6-9-18-14-16-7-3-8-17-14/h3,7-8,11H,1-2,4-6,9-10H2,(H,16,17,18)(H2,19,20,21,23) |
| InChIKey | QHVFRLBGJJDASR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |