C17H20IN3O5 — CID 55307465
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-[(2-iodobenzoyl)amino]acetate (PubChem CID 55307465) has the molecular formula C17H20IN3O5 and a molecular weight of 473.27 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-[(2-iodobenzoyl)amino]acetate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-[(2-iodobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55307465 |
| Molecular Formula | C17H20IN3O5 |
| Molecular Weight | 473.27 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-[(2-iodobenzoyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccccc1I)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H20IN3O5/c18-13-8-4-3-7-12(13)16(24)19-9-15(23)26-10-14(22)21-17(25)20-11-5-1-2-6-11/h3-4,7-8,11H,1-2,5-6,9-10H2,(H,19,24)(H2,20,21,22,25) |
| InChIKey | ISISCAJINYNUGU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|