C19H25N3O5 — CID 7132649
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] (3R)-3-acetamido-3-phenylpropanoate (PubChem CID 7132649) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (3R)-3-acetamido-3-phenylpropanoate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (3R)-3-acetamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 7132649 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (3R)-3-acetamido-3-phenylpropanoate |
| SMILES | CC(=O)N[C@H](CC(=O)OCC(=O)NC(=O)NC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H25N3O5/c1-13(23)20-16(14-7-3-2-4-8-14)11-18(25)27-12-17(24)22-19(26)21-15-9-5-6-10-15/h2-4,7-8,15-16H,5-6,9-12H2,1H3,(H,20,23)(H2,21,22,24,26)/t16-/m1/s1 |
| InChIKey | AIZRZVJWLRLTSP-MRXNPFEDSA-N |
| XLogP | 1.57 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |