C26H31N3O5 — CID 42970740
[1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-benzamido-3-phenylpropanoate (PubChem CID 42970740) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is [1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-benzamido-3-phenylpropanoate.
| Compound Name | [1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 42970740 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | [1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-benzamido-3-phenylpropanoate |
| SMILES | CC(OC(=O)CC(NC(=O)c1ccccc1)c1ccccc1)C(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C26H31N3O5/c1-18(24(31)29-26(33)27-21-15-9-4-10-16-21)34-23(30)17-22(19-11-5-2-6-12-19)28-25(32)20-13-7-3-8-14-20/h2-3,5-8,11-14,18,21-22H,4,9-10,15-17H2,1H3,(H,28,32)(H2,27,29,31,33) |
| InChIKey | CXJRRSSGKOKKGU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |