C22H24N2O4S — CID 7842805
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] (2S)-2-phenyl-2-phenylsulfanylacetate (PubChem CID 7842805) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (2S)-2-phenyl-2-phenylsulfanylacetate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (2S)-2-phenyl-2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 7842805 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (2S)-2-phenyl-2-phenylsulfanylacetate |
| SMILES | O=C(COC(=O)[C@@H](Sc1ccccc1)c1ccccc1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C22H24N2O4S/c25-19(24-22(27)23-17-11-7-8-12-17)15-28-21(26)20(16-9-3-1-4-10-16)29-18-13-5-2-6-14-18/h1-6,9-10,13-14,17,20H,7-8,11-12,15H2,(H2,23,24,25,27)/t20-/m0/s1 |
| InChIKey | YCBSEAHKBCOZBQ-FQEVSTJZSA-N |
| XLogP | 3.83 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |