C16H21NO3S — CID 7806696
[2-(cyclopentylamino)-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate (PubChem CID 7806696) has the molecular formula C16H21NO3S and a molecular weight of 307.41 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 7806696 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate |
| SMILES | C[C@H](Sc1ccccc1)C(=O)OCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H21NO3S/c1-12(21-14-9-3-2-4-10-14)16(19)20-11-15(18)17-13-7-5-6-8-13/h2-4,9-10,12-13H,5-8,11H2,1H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | ORJPIUSPJQWWNZ-LBPRGKRZSA-N |
| XLogP | 2.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |