C19H27NO3S — CID 8979821
[(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] (2S)-2-phenylsulfanylpropanoate (PubChem CID 8979821) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] (2S)-2-phenylsulfanylpropanoate.
| Compound Name | [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] (2S)-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 8979821 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] (2S)-2-phenylsulfanylpropanoate |
| SMILES | C[C@H](Sc1ccccc1)C(=O)O[C@H](C)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C19H27NO3S/c1-14(18(21)20-16-10-6-3-4-7-11-16)23-19(22)15(2)24-17-12-8-5-9-13-17/h5,8-9,12-16H,3-4,6-7,10-11H2,1-2H3,(H,20,21)/t14-,15+/m1/s1 |
| InChIKey | CRCOELKXRCJVBV-CABCVRRESA-N |
| XLogP | 3.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |