C20H29NO3 — CID 8954502
[(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] 2-methyl-2-phenylpropanoate (PubChem CID 8954502) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is [(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] 2-methyl-2-phenylpropanoate.
| Compound Name | [(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] 2-methyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 8954502 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | [(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] 2-methyl-2-phenylpropanoate |
| SMILES | C[C@H](OC(=O)C(C)(C)c1ccccc1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C20H29NO3/c1-15(18(22)21-17-13-9-4-5-10-14-17)24-19(23)20(2,3)16-11-7-6-8-12-16/h6-8,11-12,15,17H,4-5,9-10,13-14H2,1-3H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | CAXIYHNCMRXBFU-HNNXBMFYSA-N |
| XLogP | 3.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |