C20H31NO2 — CID 19203440
2-(4-tert-butylphenoxy)-N-cycloheptylpropanamide (PubChem CID 19203440) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-cycloheptylpropanamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-cycloheptylpropanamide |
|---|---|
| PubChem CID | 19203440 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-cycloheptylpropanamide |
| SMILES | CC(Oc1ccc(C(C)(C)C)cc1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C20H31NO2/c1-15(19(22)21-17-9-7-5-6-8-10-17)23-18-13-11-16(12-14-18)20(2,3)4/h11-15,17H,5-10H2,1-4H3,(H,21,22) |
| InChIKey | HWMCSUDUHSCUHF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |