C19H31ClN2O2 — CID 119475538
N-(4-aminocyclohexyl)-2-(4-tert-butylphenoxy)propanamide;hydrochloride (PubChem CID 119475538) has the molecular formula C19H31ClN2O2 and a molecular weight of 354.92 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-(4-tert-butylphenoxy)propanamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-2-(4-tert-butylphenoxy)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119475538 |
| Molecular Formula | C19H31ClN2O2 |
| Molecular Weight | 354.92 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-(4-tert-butylphenoxy)propanamide;hydrochloride |
| SMILES | CC(Oc1ccc(C(C)(C)C)cc1)C(=O)NC1CCC(N)CC1.Cl |
| InChI | InChI=1S/C19H30N2O2.ClH/c1-13(18(22)21-16-9-7-15(20)8-10-16)23-17-11-5-14(6-12-17)19(2,3)4;/h5-6,11-13,15-16H,7-10,20H2,1-4H3,(H,21,22);1H |
| InChIKey | FJFWQRRWSIUXJO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.92 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |