C16H22N2O3 — CID 37289545
[(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] pyridine-2-carboxylate (PubChem CID 37289545) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] pyridine-2-carboxylate.
| Compound Name | [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 37289545 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] pyridine-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1ccccn1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C16H22N2O3/c1-12(21-16(20)14-10-6-7-11-17-14)15(19)18-13-8-4-2-3-5-9-13/h6-7,10-13H,2-5,8-9H2,1H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | IDXNOYCVAVLFHV-GFCCVEGCSA-N |
| XLogP | 2.47 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |