C18H15IN2O5 — CID 55307473
(2-benzamido-2-oxoethyl) 2-[(2-iodobenzoyl)amino]acetate (PubChem CID 55307473) has the molecular formula C18H15IN2O5 and a molecular weight of 466.23 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 2-[(2-iodobenzoyl)amino]acetate.
| Compound Name | (2-benzamido-2-oxoethyl) 2-[(2-iodobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55307473 |
| Molecular Formula | C18H15IN2O5 |
| Molecular Weight | 466.23 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 2-[(2-iodobenzoyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccccc1I)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H15IN2O5/c19-14-9-5-4-8-13(14)18(25)20-10-16(23)26-11-15(22)21-17(24)12-6-2-1-3-7-12/h1-9H,10-11H2,(H,20,25)(H,21,22,24) |
| InChIKey | XDRIXIWFXQKSGA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|