C17H14FNO4 — CID 2357812
phenacyl 2-[(2-fluorobenzoyl)amino]acetate (PubChem CID 2357812) has the molecular formula C17H14FNO4 and a molecular weight of 315.30 g/mol. Its IUPAC name is phenacyl 2-[(2-fluorobenzoyl)amino]acetate.
| Compound Name | phenacyl 2-[(2-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2357812 |
| Molecular Formula | C17H14FNO4 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | phenacyl 2-[(2-fluorobenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccccc1F)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H14FNO4/c18-14-9-5-4-8-13(14)17(22)19-10-16(21)23-11-15(20)12-6-2-1-3-7-12/h1-9H,10-11H2,(H,19,22) |
| InChIKey | VKLRTAIZPGTOHA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |