C17H13Cl2FN2O4 — CID 9270497
[2-(3,5-dichloroanilino)-2-oxoethyl] 2-[(2-fluorobenzoyl)amino]acetate (PubChem CID 9270497) has the molecular formula C17H13Cl2FN2O4 and a molecular weight of 399.21 g/mol. Its IUPAC name is [2-(3,5-dichloroanilino)-2-oxoethyl] 2-[(2-fluorobenzoyl)amino]acetate.
| Compound Name | [2-(3,5-dichloroanilino)-2-oxoethyl] 2-[(2-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 9270497 |
| Molecular Formula | C17H13Cl2FN2O4 |
| Molecular Weight | 399.21 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | [2-(3,5-dichloroanilino)-2-oxoethyl] 2-[(2-fluorobenzoyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccccc1F)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H13Cl2FN2O4/c18-10-5-11(19)7-12(6-10)22-15(23)9-26-16(24)8-21-17(25)13-3-1-2-4-14(13)20/h1-7H,8-9H2,(H,21,25)(H,22,23) |
| InChIKey | KQCJTIKYJQYEEP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |