C17H14ClFN2O4 — CID 2602170
[2-(3-chloroanilino)-2-oxoethyl] 2-[(2-fluorobenzoyl)amino]acetate (PubChem CID 2602170) has the molecular formula C17H14ClFN2O4 and a molecular weight of 364.76 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 2-[(2-fluorobenzoyl)amino]acetate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] 2-[(2-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2602170 |
| Molecular Formula | C17H14ClFN2O4 |
| Molecular Weight | 364.76 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] 2-[(2-fluorobenzoyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccccc1F)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H14ClFN2O4/c18-11-4-3-5-12(8-11)21-15(22)10-25-16(23)9-20-17(24)13-6-1-2-7-14(13)19/h1-8H,9-10H2,(H,20,24)(H,21,22) |
| InChIKey | SWMIKWARIQELIU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.76 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |