C17H16ClN3O6 — CID 8871080
[2-(3-chloroanilino)-2-oxoethyl] 2-[[2-(furan-2-carbonylamino)acetyl]amino]acetate (PubChem CID 8871080) has the molecular formula C17H16ClN3O6 and a molecular weight of 393.78 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 2-[[2-(furan-2-carbonylamino)acetyl]amino]acetate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] 2-[[2-(furan-2-carbonylamino)acetyl]amino]acetate |
|---|---|
| PubChem CID | 8871080 |
| Molecular Formula | C17H16ClN3O6 |
| Molecular Weight | 393.78 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] 2-[[2-(furan-2-carbonylamino)acetyl]amino]acetate |
| SMILES | O=C(CNC(=O)c1ccco1)NCC(=O)OCC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H16ClN3O6/c18-11-3-1-4-12(7-11)21-15(23)10-27-16(24)9-19-14(22)8-20-17(25)13-5-2-6-26-13/h1-7H,8-10H2,(H,19,22)(H,20,25)(H,21,23) |
| InChIKey | LWAYUWMAZPAIKB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.78 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |