C16H16ClN3O5 — CID 9269646
N-[2-[[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 9269646) has the molecular formula C16H16ClN3O5 and a molecular weight of 365.77 g/mol. Its IUPAC name is N-[2-[[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9269646 |
| Molecular Formula | C16H16ClN3O5 |
| Molecular Weight | 365.77 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | N-[2-[[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | COc1ccc(NC(=O)CNC(=O)CNC(=O)c2ccco2)cc1Cl |
| InChI | InChI=1S/C16H16ClN3O5/c1-24-12-5-4-10(7-11(12)17)20-15(22)9-18-14(21)8-19-16(23)13-3-2-6-25-13/h2-7H,8-9H2,1H3,(H,18,21)(H,19,23)(H,20,22) |
| InChIKey | WAINGMCWSUYMHT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.77 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |