C17H18ClN3O3 — CID 24559562
2-(benzylcarbamoylamino)-N-(3-chloro-4-methoxyphenyl)acetamide (PubChem CID 24559562) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is 2-(benzylcarbamoylamino)-N-(3-chloro-4-methoxyphenyl)acetamide.
| Compound Name | 2-(benzylcarbamoylamino)-N-(3-chloro-4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 24559562 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-(benzylcarbamoylamino)-N-(3-chloro-4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CNC(=O)NCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C17H18ClN3O3/c1-24-15-8-7-13(9-14(15)18)21-16(22)11-20-17(23)19-10-12-5-3-2-4-6-12/h2-9H,10-11H2,1H3,(H,21,22)(H2,19,20,23) |
| InChIKey | VMZYKIJNNMOFKK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |