C23H22ClN3O3 — CID 54843765
N-benzyl-4-[[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]amino]benzamide (PubChem CID 54843765) has the molecular formula C23H22ClN3O3 and a molecular weight of 423.90 g/mol. Its IUPAC name is N-benzyl-4-[[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]amino]benzamide.
| Compound Name | N-benzyl-4-[[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54843765 |
| Molecular Formula | C23H22ClN3O3 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | N-benzyl-4-[[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]amino]benzamide |
| SMILES | COc1ccc(NC(=O)CNc2ccc(C(=O)NCc3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C23H22ClN3O3/c1-30-21-12-11-19(13-20(21)24)27-22(28)15-25-18-9-7-17(8-10-18)23(29)26-14-16-5-3-2-4-6-16/h2-13,25H,14-15H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | OOLVTSASWKYZER-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |