C22H19Cl2N3O2 — CID 54844035
N-benzyl-4-[[2-(3,5-dichloroanilino)-2-oxoethyl]amino]benzamide (PubChem CID 54844035) has the molecular formula C22H19Cl2N3O2 and a molecular weight of 428.32 g/mol. Its IUPAC name is N-benzyl-4-[[2-(3,5-dichloroanilino)-2-oxoethyl]amino]benzamide.
| Compound Name | N-benzyl-4-[[2-(3,5-dichloroanilino)-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54844035 |
| Molecular Formula | C22H19Cl2N3O2 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | N-benzyl-4-[[2-(3,5-dichloroanilino)-2-oxoethyl]amino]benzamide |
| SMILES | O=C(CNc1ccc(C(=O)NCc2ccccc2)cc1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H19Cl2N3O2/c23-17-10-18(24)12-20(11-17)27-21(28)14-25-19-8-6-16(7-9-19)22(29)26-13-15-4-2-1-3-5-15/h1-12,25H,13-14H2,(H,26,29)(H,27,28) |
| InChIKey | OKEDIESAOWRZOY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |