C29H27N3O3 — CID 54843886
N-benzyl-4-[[2-oxo-2-(3-phenylmethoxyanilino)ethyl]amino]benzamide (PubChem CID 54843886) has the molecular formula C29H27N3O3 and a molecular weight of 465.55 g/mol. Its IUPAC name is N-benzyl-4-[[2-oxo-2-(3-phenylmethoxyanilino)ethyl]amino]benzamide.
| Compound Name | N-benzyl-4-[[2-oxo-2-(3-phenylmethoxyanilino)ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54843886 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | N-benzyl-4-[[2-oxo-2-(3-phenylmethoxyanilino)ethyl]amino]benzamide |
| SMILES | O=C(CNc1ccc(C(=O)NCc2ccccc2)cc1)Nc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H27N3O3/c33-28(32-26-12-7-13-27(18-26)35-21-23-10-5-2-6-11-23)20-30-25-16-14-24(15-17-25)29(34)31-19-22-8-3-1-4-9-22/h1-18,30H,19-21H2,(H,31,34)(H,32,33) |
| InChIKey | ARXBZKGSZUHVHH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |