C20H25N3O2 — CID 24559411
2-(benzylcarbamoylamino)-N-(4-tert-butylphenyl)acetamide (PubChem CID 24559411) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-(benzylcarbamoylamino)-N-(4-tert-butylphenyl)acetamide.
| Compound Name | 2-(benzylcarbamoylamino)-N-(4-tert-butylphenyl)acetamide |
|---|---|
| PubChem CID | 24559411 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 2-(benzylcarbamoylamino)-N-(4-tert-butylphenyl)acetamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)CNC(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25N3O2/c1-20(2,3)16-9-11-17(12-10-16)23-18(24)14-22-19(25)21-13-15-7-5-4-6-8-15/h4-12H,13-14H2,1-3H3,(H,23,24)(H2,21,22,25) |
| InChIKey | KTRYCTVQJNPONL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |