C18H21N3O4 — CID 9225396
N-[2-oxo-2-[[2-oxo-2-(4-propylanilino)ethyl]amino]ethyl]furan-2-carboxamide (PubChem CID 9225396) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-[2-oxo-2-[[2-oxo-2-(4-propylanilino)ethyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-oxo-2-[[2-oxo-2-(4-propylanilino)ethyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9225396 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-[2-oxo-2-[[2-oxo-2-(4-propylanilino)ethyl]amino]ethyl]furan-2-carboxamide |
| SMILES | CCCc1ccc(NC(=O)CNC(=O)CNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C18H21N3O4/c1-2-4-13-6-8-14(9-7-13)21-17(23)12-19-16(22)11-20-18(24)15-5-3-10-25-15/h3,5-10H,2,4,11-12H2,1H3,(H,19,22)(H,20,24)(H,21,23) |
| InChIKey | UHZNFLDQAXVXKP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |