C14H15N3O5S — CID 9141000
N-[2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl]furan-2-carboxamide (PubChem CID 9141000) has the molecular formula C14H15N3O5S and a molecular weight of 337.36 g/mol. Its IUPAC name is N-[2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9141000 |
| Molecular Formula | C14H15N3O5S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | N-[2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl]furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)CNC(=O)c2ccco2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C14H15N3O5S/c1-9-4-5-10(7-12(9)23(15,20)21)17-13(18)8-16-14(19)11-3-2-6-22-11/h2-7H,8H2,1H3,(H,16,19)(H,17,18)(H2,15,20,21) |
| InChIKey | WLXZZRWRBULWJD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |