C16H19N3O3 — CID 47031833
N-[2-[(3,4-dimethylphenyl)carbamoylamino]ethyl]furan-2-carboxamide (PubChem CID 47031833) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[2-[(3,4-dimethylphenyl)carbamoylamino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(3,4-dimethylphenyl)carbamoylamino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 47031833 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-[2-[(3,4-dimethylphenyl)carbamoylamino]ethyl]furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)NCCNC(=O)c2ccco2)cc1C |
| InChI | InChI=1S/C16H19N3O3/c1-11-5-6-13(10-12(11)2)19-16(21)18-8-7-17-15(20)14-4-3-9-22-14/h3-6,9-10H,7-8H2,1-2H3,(H,17,20)(H2,18,19,21) |
| InChIKey | VPEJEXMXSZLIKD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|