C22H22N4O4 — CID 121062902
N-[2-[[4-(benzylcarbamoylamino)benzoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 121062902) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is N-[2-[[4-(benzylcarbamoylamino)benzoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[4-(benzylcarbamoylamino)benzoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 121062902 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-[2-[[4-(benzylcarbamoylamino)benzoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)Nc1ccc(C(=O)NCCNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C22H22N4O4/c27-20(23-12-13-24-21(28)19-7-4-14-30-19)17-8-10-18(11-9-17)26-22(29)25-15-16-5-2-1-3-6-16/h1-11,14H,12-13,15H2,(H,23,27)(H,24,28)(H2,25,26,29) |
| InChIKey | BWAVOEWUWKHUFB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|